C19H21N3O2 — CID 68771708
[1-[1-(1H-indol-5-yl)ethyl]piperidin-4-yl]-(1,3-oxazol-2-yl)methanone (PubChem CID 68771708) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [1-[1-(1H-indol-5-yl)ethyl]piperidin-4-yl]-(1,3-oxazol-2-yl)methanone.
| Compound Name | [1-[1-(1H-indol-5-yl)ethyl]piperidin-4-yl]-(1,3-oxazol-2-yl)methanone |
|---|---|
| PubChem CID | 68771708 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [1-[1-(1H-indol-5-yl)ethyl]piperidin-4-yl]-(1,3-oxazol-2-yl)methanone |
| SMILES | CC(c1ccc2[nH]ccc2c1)N1CCC(C(=O)c2ncco2)CC1 |
| InChI | InChI=1S/C19H21N3O2/c1-13(15-2-3-17-16(12-15)4-7-20-17)22-9-5-14(6-10-22)18(23)19-21-8-11-24-19/h2-4,7-8,11-14,20H,5-6,9-10H2,1H3 |
| InChIKey | XXWQOWCNECZZCW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |