About 1-pentylpyrazin-2-one
1-pentylpyrazin-2-one (PubChem CID 68772025) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-pentylpyrazin-2-one.
Molecular Properties
| Compound Name | 1-pentylpyrazin-2-one |
| PubChem CID | 68772025 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-pentylpyrazin-2-one |
| SMILES | CCCCCn1ccncc1=O |
| InChI | InChI=1S/C9H14N2O/c1-2-3-4-6-11-7-5-10-8-9(11)12/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | IVUZRDNAYBROGQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylpyrazin-2-one?
The IUPAC name of 1-pentylpyrazin-2-one (CID 68772025) is 1-pentylpyrazin-2-one.
What is the SMILES notation for 1-pentylpyrazin-2-one?
The canonical SMILES for 1-pentylpyrazin-2-one is CCCCCn1ccncc1=O.
What is the InChIKey of 1-pentylpyrazin-2-one?
The InChIKey is IVUZRDNAYBROGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-2-3-4-6-11-7-5-10-8-9(11)12/h5,7-8H,2-4,6H2,1H3.
What are the key properties of 1-pentylpyrazin-2-one?
1-pentylpyrazin-2-one has a molecular weight of 166.22 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylpyrazin-2-one is sourced from PubChem (CID 68772025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).