C15H17FN6O — CID 68772463
3-(4-fluorophenyl)-6-N-(2-methoxyethyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 68772463) has the molecular formula C15H17FN6O and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6-N-(2-methoxyethyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 3-(4-fluorophenyl)-6-N-(2-methoxyethyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 68772463 |
| Molecular Formula | C15H17FN6O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-(4-fluorophenyl)-6-N-(2-methoxyethyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | COCCNc1nc(N)c2c(-c3ccc(F)cc3)nn(C)c2n1 |
| InChI | InChI=1S/C15H17FN6O/c1-22-14-11(12(21-22)9-3-5-10(16)6-4-9)13(17)19-15(20-14)18-7-8-23-2/h3-6H,7-8H2,1-2H3,(H3,17,18,19,20) |
| InChIKey | HXMVYTUDGKREEU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|