About 5,10,15-trifluoro-21H-corrin
5,10,15-trifluoro-21H-corrin (PubChem CID 68772900) has the molecular formula C19H9F3N4
and a molecular weight of 350.30 g/mol. Its IUPAC name is 5,10,15-trifluoro-21H-corrin.
Molecular Properties
| Compound Name | 5,10,15-trifluoro-21H-corrin |
| PubChem CID | 68772900 |
| Molecular Formula | C19H9F3N4 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5,10,15-trifluoro-21H-corrin |
| SMILES | F/C1=C2\C=CC(=N2)/C(F)=C2/C=CC(=N2)/C(F)=c2/cc/c([nH]2)=C2\C=CC1=N2 |
| InChI | InChI=1S/C19H9F3N4/c20-17-11-3-1-9(23-11)10-2-4-12(24-10)18(21)14-6-8-16(26-14)19(22)15-7-5-13(17)25-15/h1-8,23H/b10-9-,17-11+,17-13+,18-12+,18-14+,19-15+,19-16+ |
| InChIKey | AXHYRAMSWXHFKZ-IXCVTHGBSA-N |
| XLogP | 2.61 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,10,15-trifluoro-21H-corrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10,15-trifluoro-21H-corrin?
The IUPAC name of 5,10,15-trifluoro-21H-corrin (CID 68772900) is 5,10,15-trifluoro-21H-corrin.
What is the SMILES notation for 5,10,15-trifluoro-21H-corrin?
The canonical SMILES for 5,10,15-trifluoro-21H-corrin is F/C1=C2\C=CC(=N2)/C(F)=C2/C=CC(=N2)/C(F)=c2/cc/c([nH]2)=C2\C=CC1=N2.
What is the InChIKey of 5,10,15-trifluoro-21H-corrin?
The InChIKey is AXHYRAMSWXHFKZ-IXCVTHGBSA-N. The full InChI is InChI=1S/C19H9F3N4/c20-17-11-3-1-9(23-11)10-2-4-12(24-10)18(21)14-6-8-16(26-14)19(22)15-7-5-13(17)25-15/h1-8,23H/b10-9-,17-11+,17-13+,18-12+,18-14+,19-15+,19-16+.
What are the key properties of 5,10,15-trifluoro-21H-corrin?
5,10,15-trifluoro-21H-corrin has a molecular weight of 350.30 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10,15-trifluoro-21H-corrin is sourced from PubChem (CID 68772900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).