About 1-(prop-2-enylamino)pyrimidine-2,4-dione
1-(prop-2-enylamino)pyrimidine-2,4-dione (PubChem CID 68773005) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 1-(prop-2-enylamino)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(prop-2-enylamino)pyrimidine-2,4-dione |
| PubChem CID | 68773005 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 1-(prop-2-enylamino)pyrimidine-2,4-dione |
| SMILES | C=CCNn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C7H9N3O2/c1-2-4-8-10-5-3-6(11)9-7(10)12/h2-3,5,8H,1,4H2,(H,9,11,12) |
| InChIKey | CNBUKYRCYANKBA-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(prop-2-enylamino)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(prop-2-enylamino)pyrimidine-2,4-dione?
The IUPAC name of 1-(prop-2-enylamino)pyrimidine-2,4-dione (CID 68773005) is 1-(prop-2-enylamino)pyrimidine-2,4-dione.
What is the SMILES notation for 1-(prop-2-enylamino)pyrimidine-2,4-dione?
The canonical SMILES for 1-(prop-2-enylamino)pyrimidine-2,4-dione is C=CCNn1ccc(=O)[nH]c1=O.
What is the InChIKey of 1-(prop-2-enylamino)pyrimidine-2,4-dione?
The InChIKey is CNBUKYRCYANKBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c1-2-4-8-10-5-3-6(11)9-7(10)12/h2-3,5,8H,1,4H2,(H,9,11,12).
What are the key properties of 1-(prop-2-enylamino)pyrimidine-2,4-dione?
1-(prop-2-enylamino)pyrimidine-2,4-dione has a molecular weight of 167.17 g/mol, XLogP of -0.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(prop-2-enylamino)pyrimidine-2,4-dione is sourced from PubChem (CID 68773005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).