C25H38BClN2O3 — CID 68773217
cis-(1S,2S)-1-amino-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-2-phenylcyclopropane-1-carboxamide;hydrochloride (PubChem CID 68773217) has the molecular formula C25H38BClN2O3 and a molecular weight of 460.86 g/mol. Its IUPAC name is cis-(1S,2S)-1-amino-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-2-phenylcyclopropane-1-carboxamide;hydrochloride.
| Compound Name | cis-(1S,2S)-1-amino-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-2-phenylcyclopropane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68773217 |
| Molecular Formula | C25H38BClN2O3 |
| Molecular Weight | 460.86 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | cis-(1S,2S)-1-amino-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-2-phenylcyclopropane-1-carboxamide;hydrochloride |
| SMILES | CC(C)C[C@H](NC(=O)[C@]1(N)C[C@H]1c1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1.Cl |
| InChI | InChI=1S/C25H37BN2O3.ClH/c1-15(2)11-21(28-22(29)25(27)14-18(25)16-9-7-6-8-10-16)26-30-20-13-17-12-19(23(17,3)4)24(20,5)31-26;/h6-10,15,17-21H,11-14,27H2,1-5H3,(H,28,29);1H/t17-,18-,19-,20+,21-,24-,25-;/m0./s1 |
| InChIKey | GZVHDJODXYPGMG-ZQSMLSCTSA-N |
| XLogP | 4.09 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|