About 2-methyl-3H-1,3-benzothiazole-2,6-diamine
2-methyl-3H-1,3-benzothiazole-2,6-diamine (PubChem CID 68773710) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-methyl-3H-1,3-benzothiazole-2,6-diamine.
Molecular Properties
| Compound Name | 2-methyl-3H-1,3-benzothiazole-2,6-diamine |
| PubChem CID | 68773710 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-methyl-3H-1,3-benzothiazole-2,6-diamine |
| SMILES | CC1(N)Nc2ccc(N)cc2S1 |
| InChI | InChI=1S/C8H11N3S/c1-8(10)11-6-3-2-5(9)4-7(6)12-8/h2-4,11H,9-10H2,1H3 |
| InChIKey | ALMUZJLCGPEFBF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3H-1,3-benzothiazole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3H-1,3-benzothiazole-2,6-diamine?
The IUPAC name of 2-methyl-3H-1,3-benzothiazole-2,6-diamine (CID 68773710) is 2-methyl-3H-1,3-benzothiazole-2,6-diamine.
What is the SMILES notation for 2-methyl-3H-1,3-benzothiazole-2,6-diamine?
The canonical SMILES for 2-methyl-3H-1,3-benzothiazole-2,6-diamine is CC1(N)Nc2ccc(N)cc2S1.
What is the InChIKey of 2-methyl-3H-1,3-benzothiazole-2,6-diamine?
The InChIKey is ALMUZJLCGPEFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c1-8(10)11-6-3-2-5(9)4-7(6)12-8/h2-4,11H,9-10H2,1H3.
What are the key properties of 2-methyl-3H-1,3-benzothiazole-2,6-diamine?
2-methyl-3H-1,3-benzothiazole-2,6-diamine has a molecular weight of 181.26 g/mol, XLogP of 1.42, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3H-1,3-benzothiazole-2,6-diamine is sourced from PubChem (CID 68773710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).