About 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid
3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid (PubChem CID 68773837) has the molecular formula C14H9FO4
and a molecular weight of 260.22 g/mol. Its IUPAC name is 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid |
| PubChem CID | 68773837 |
| Molecular Formula | C14H9FO4 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid |
| SMILES | CC(=CC1=C(F)C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C14H9FO4/c1-7(14(18)19)6-10-11(15)13(17)9-5-3-2-4-8(9)12(10)16/h2-6H,1H3,(H,18,19) |
| InChIKey | NVBQFYMTJRPSBK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid?
The IUPAC name of 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid (CID 68773837) is 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid.
What is the SMILES notation for 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid?
The canonical SMILES for 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid is CC(=CC1=C(F)C(=O)c2ccccc2C1=O)C(=O)O.
What is the InChIKey of 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid?
The InChIKey is NVBQFYMTJRPSBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FO4/c1-7(14(18)19)6-10-11(15)13(17)9-5-3-2-4-8(9)12(10)16/h2-6H,1H3,(H,18,19).
What are the key properties of 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid?
3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid has a molecular weight of 260.22 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluoro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoic acid is sourced from PubChem (CID 68773837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).