C22H24F3NO2 — CID 68773919
2-[2-methyl-4-[[2-phenyl-4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]acetic acid (PubChem CID 68773919) has the molecular formula C22H24F3NO2 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[2-methyl-4-[[2-phenyl-4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[2-methyl-4-[[2-phenyl-4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 68773919 |
| Molecular Formula | C22H24F3NO2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2-[2-methyl-4-[[2-phenyl-4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]acetic acid |
| SMILES | CC1CC(Cc2ccc(C(F)(F)F)cc2-c2ccccc2)CCN1CC(=O)O |
| InChI | InChI=1S/C22H24F3NO2/c1-15-11-16(9-10-26(15)14-21(27)28)12-18-7-8-19(22(23,24)25)13-20(18)17-5-3-2-4-6-17/h2-8,13,15-16H,9-12,14H2,1H3,(H,27,28) |
| InChIKey | QUKRJGXKZTWJIQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |