About 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one
4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one (PubChem CID 68774091) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one |
| PubChem CID | 68774091 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one |
| SMILES | CC#CCC1NC(=O)SC1C |
| InChI | InChI=1S/C8H11NOS/c1-3-4-5-7-6(2)11-8(10)9-7/h6-7H,5H2,1-2H3,(H,9,10) |
| InChIKey | FEAGEWZQATXNDU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one?
The IUPAC name of 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one (CID 68774091) is 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one.
What is the SMILES notation for 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one?
The canonical SMILES for 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one is CC#CCC1NC(=O)SC1C.
What is the InChIKey of 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one?
The InChIKey is FEAGEWZQATXNDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS/c1-3-4-5-7-6(2)11-8(10)9-7/h6-7H,5H2,1-2H3,(H,9,10).
What are the key properties of 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one?
4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one has a molecular weight of 169.25 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-ynyl-5-methyl-1,3-thiazolidin-2-one is sourced from PubChem (CID 68774091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).