C18H23NO4 — CID 68774668
8-methoxy-3-(2,4,5-trimethylphenyl)-1-oxa-8-azaspiro[4.5]decane-2,4-dione (PubChem CID 68774668) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 8-methoxy-3-(2,4,5-trimethylphenyl)-1-oxa-8-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methoxy-3-(2,4,5-trimethylphenyl)-1-oxa-8-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 68774668 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 8-methoxy-3-(2,4,5-trimethylphenyl)-1-oxa-8-azaspiro[4.5]decane-2,4-dione |
| SMILES | CON1CCC2(CC1)OC(=O)C(c1cc(C)c(C)cc1C)C2=O |
| InChI | InChI=1S/C18H23NO4/c1-11-9-13(3)14(10-12(11)2)15-16(20)18(23-17(15)21)5-7-19(22-4)8-6-18/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | XNNORYQQOMAEBV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|