C24H18Cl2FN3O2 — CID 68775046
(2,4-dichloro-5-fluorophenyl)-[7-(2-methyl-3H-benzimidazol-5-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methanone (PubChem CID 68775046) has the molecular formula C24H18Cl2FN3O2 and a molecular weight of 470.33 g/mol. Its IUPAC name is (2,4-dichloro-5-fluorophenyl)-[7-(2-methyl-3H-benzimidazol-5-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methanone.
| Compound Name | (2,4-dichloro-5-fluorophenyl)-[7-(2-methyl-3H-benzimidazol-5-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methanone |
|---|---|
| PubChem CID | 68775046 |
| Molecular Formula | C24H18Cl2FN3O2 |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | (2,4-dichloro-5-fluorophenyl)-[7-(2-methyl-3H-benzimidazol-5-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methanone |
| SMILES | Cc1nc2ccc(-c3ccc4c(c3)CN(C(=O)c3cc(F)c(Cl)cc3Cl)CCO4)cc2[nH]1 |
| InChI | InChI=1S/C24H18Cl2FN3O2/c1-13-28-21-4-2-15(9-22(21)29-13)14-3-5-23-16(8-14)12-30(6-7-32-23)24(31)17-10-20(27)19(26)11-18(17)25/h2-5,8-11H,6-7,12H2,1H3,(H,28,29) |
| InChIKey | YMMUIQWUNQVNER-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|