C19H28N2O3S — CID 68775332
3-(1-butoxyethenyl)-5,5-dimethyl-2-morpholin-4-yl-4,6-dihydrothieno[2,3-c]pyridin-7-one (PubChem CID 68775332) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 3-(1-butoxyethenyl)-5,5-dimethyl-2-morpholin-4-yl-4,6-dihydrothieno[2,3-c]pyridin-7-one.
| Compound Name | 3-(1-butoxyethenyl)-5,5-dimethyl-2-morpholin-4-yl-4,6-dihydrothieno[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 68775332 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-(1-butoxyethenyl)-5,5-dimethyl-2-morpholin-4-yl-4,6-dihydrothieno[2,3-c]pyridin-7-one |
| SMILES | C=C(OCCCC)c1c(N2CCOCC2)sc2c1CC(C)(C)NC2=O |
| InChI | InChI=1S/C19H28N2O3S/c1-5-6-9-24-13(2)15-14-12-19(3,4)20-17(22)16(14)25-18(15)21-7-10-23-11-8-21/h2,5-12H2,1,3-4H3,(H,20,22) |
| InChIKey | SEOIUIVCRQXPED-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|