C34H32O8 — CID 68775756
4-[3,5,7-tris(3,4-dihydroxyphenyl)-1-adamantyl]benzene-1,2-diol (PubChem CID 68775756) has the molecular formula C34H32O8 and a molecular weight of 568.62 g/mol. Its IUPAC name is 4-[3,5,7-tris(3,4-dihydroxyphenyl)-1-adamantyl]benzene-1,2-diol.
| Compound Name | 4-[3,5,7-tris(3,4-dihydroxyphenyl)-1-adamantyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 68775756 |
| Molecular Formula | C34H32O8 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 4-[3,5,7-tris(3,4-dihydroxyphenyl)-1-adamantyl]benzene-1,2-diol |
| SMILES | Oc1ccc(C23CC4(c5ccc(O)c(O)c5)CC(c5ccc(O)c(O)c5)(C2)CC(c2ccc(O)c(O)c2)(C3)C4)cc1O |
| InChI | InChI=1S/C34H32O8/c35-23-5-1-19(9-27(23)39)31-13-32(20-2-6-24(36)28(40)10-20)16-33(14-31,21-3-7-25(37)29(41)11-21)18-34(15-31,17-32)22-4-8-26(38)30(42)12-22/h1-12,35-42H,13-18H2 |
| InChIKey | AWVGORFRURSCOD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|