C17H14N6O — CID 68775878
4-ethoxy-6-quinolin-3-ylpteridin-2-amine (PubChem CID 68775878) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 4-ethoxy-6-quinolin-3-ylpteridin-2-amine.
| Compound Name | 4-ethoxy-6-quinolin-3-ylpteridin-2-amine |
|---|---|
| PubChem CID | 68775878 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-ethoxy-6-quinolin-3-ylpteridin-2-amine |
| SMILES | CCOc1nc(N)nc2ncc(-c3cnc4ccccc4c3)nc12 |
| InChI | InChI=1S/C17H14N6O/c1-2-24-16-14-15(22-17(18)23-16)20-9-13(21-14)11-7-10-5-3-4-6-12(10)19-8-11/h3-9H,2H2,1H3,(H2,18,20,22,23) |
| InChIKey | MKIVZSJBUIDLLL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |