About 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine
4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine (PubChem CID 68776036) has the molecular formula C9H6ClN5S
and a molecular weight of 251.70 g/mol. Its IUPAC name is 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine |
| PubChem CID | 68776036 |
| Molecular Formula | C9H6ClN5S |
| Molecular Weight | 251.70 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2c(Cl)nc3sccn23)n1 |
| InChI | InChI=1S/C9H6ClN5S/c10-7-6(5-1-2-12-8(11)13-5)15-3-4-16-9(15)14-7/h1-4H,(H2,11,12,13) |
| InChIKey | XNBRJQPDYLGDMO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.70 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine?
The IUPAC name of 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine (CID 68776036) is 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine.
What is the SMILES notation for 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine?
The canonical SMILES for 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine is Nc1nccc(-c2c(Cl)nc3sccn23)n1.
What is the InChIKey of 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine?
The InChIKey is XNBRJQPDYLGDMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN5S/c10-7-6(5-1-2-12-8(11)13-5)15-3-4-16-9(15)14-7/h1-4H,(H2,11,12,13).
What are the key properties of 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine?
4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine has a molecular weight of 251.70 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-amine is sourced from PubChem (CID 68776036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).