C22H40O4 — CID 68777214
1,2-di(heptan-2-yl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 68777214) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is 1,2-di(heptan-2-yl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 1,2-di(heptan-2-yl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 68777214 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 1,2-di(heptan-2-yl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | CCCCCC(C)C1(C(=O)O)CCCCC1(C(=O)O)C(C)CCCCC |
| InChI | InChI=1S/C22H40O4/c1-5-7-9-13-17(3)21(19(23)24)15-11-12-16-22(21,20(25)26)18(4)14-10-8-6-2/h17-18H,5-16H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | RYCARKVBFVCWMM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|