About [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate
[1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate (PubChem CID 68777321) has the molecular formula C18H24N6O3
and a molecular weight of 372.43 g/mol. Its IUPAC name is [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate.
Molecular Properties
| Compound Name | [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate |
| PubChem CID | 68777321 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate |
| SMILES | CCOc1nc(N)nc2ncc(C(=O)OC(C)(C)CN3CC=CCC3)nc12 |
| InChI | InChI=1S/C18H24N6O3/c1-4-26-15-13-14(22-17(19)23-15)20-10-12(21-13)16(25)27-18(2,3)11-24-8-6-5-7-9-24/h5-6,10H,4,7-9,11H2,1-3H3,(H2,19,20,22,23) |
| InChIKey | AJIPVPRMZRYAJE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate?
The IUPAC name of [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate (CID 68777321) is [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate.
What is the SMILES notation for [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate?
The canonical SMILES for [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate is CCOc1nc(N)nc2ncc(C(=O)OC(C)(C)CN3CC=CCC3)nc12.
What is the InChIKey of [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate?
The InChIKey is AJIPVPRMZRYAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N6O3/c1-4-26-15-13-14(22-17(19)23-15)20-10-12(21-13)16(25)27-18(2,3)11-24-8-6-5-7-9-24/h5-6,10H,4,7-9,11H2,1-3H3,(H2,19,20,22,23).
What are the key properties of [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate?
[1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate has a molecular weight of 372.43 g/mol, XLogP of 1.60, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,6-dihydro-2H-pyridin-1-yl)-2-methylpropan-2-yl] 2-amino-4-ethoxypteridine-6-carboxylate is sourced from PubChem (CID 68777321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).