About 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine
4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine (PubChem CID 68777622) has the molecular formula C17H19N5O4
and a molecular weight of 357.37 g/mol. Its IUPAC name is 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine.
Molecular Properties
| Compound Name | 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine |
| PubChem CID | 68777622 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine |
| SMILES | CCOc1nc(N)nc2ncc(-c3cc(OC)c(OC)c(OC)c3)nc12 |
| InChI | InChI=1S/C17H19N5O4/c1-5-26-16-13-15(21-17(18)22-16)19-8-10(20-13)9-6-11(23-2)14(25-4)12(7-9)24-3/h6-8H,5H2,1-4H3,(H2,18,19,21,22) |
| InChIKey | UJTSZYCGVFUPFV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine?
The IUPAC name of 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine (CID 68777622) is 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine.
What is the SMILES notation for 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine?
The canonical SMILES for 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine is CCOc1nc(N)nc2ncc(-c3cc(OC)c(OC)c(OC)c3)nc12.
What is the InChIKey of 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine?
The InChIKey is UJTSZYCGVFUPFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O4/c1-5-26-16-13-15(21-17(18)22-16)19-8-10(20-13)9-6-11(23-2)14(25-4)12(7-9)24-3/h6-8H,5H2,1-4H3,(H2,18,19,21,22).
What are the key properties of 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine?
4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine has a molecular weight of 357.37 g/mol, XLogP of 2.09, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-6-(3,4,5-trimethoxyphenyl)pteridin-2-amine is sourced from PubChem (CID 68777622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).