C24H31N5O — CID 68777898
(4-cyclohexylphenyl)-[3-(4-pyrimidin-2-ylpiperazin-1-yl)azetidin-1-yl]methanone (PubChem CID 68777898) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is (4-cyclohexylphenyl)-[3-(4-pyrimidin-2-ylpiperazin-1-yl)azetidin-1-yl]methanone.
| Compound Name | (4-cyclohexylphenyl)-[3-(4-pyrimidin-2-ylpiperazin-1-yl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 68777898 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | (4-cyclohexylphenyl)-[3-(4-pyrimidin-2-ylpiperazin-1-yl)azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc(C2CCCCC2)cc1)N1CC(N2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C24H31N5O/c30-23(21-9-7-20(8-10-21)19-5-2-1-3-6-19)29-17-22(18-29)27-13-15-28(16-14-27)24-25-11-4-12-26-24/h4,7-12,19,22H,1-3,5-6,13-18H2 |
| InChIKey | GQDQJKYUALCZNP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |