About 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid
2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid (PubChem CID 68778433) has the molecular formula C21H16N2O2
and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
| PubChem CID | 68778433 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
| SMILES | Cc1cc(-c2c[nH]c3ncc(-c4ccccc4)cc23)ccc1C(=O)O |
| InChI | InChI=1S/C21H16N2O2/c1-13-9-15(7-8-17(13)21(24)25)19-12-23-20-18(19)10-16(11-22-20)14-5-3-2-4-6-14/h2-12H,1H3,(H,22,23)(H,24,25) |
| InChIKey | HYJDKBZVTDLBMB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid?
The IUPAC name of 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid (CID 68778433) is 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid.
What is the SMILES notation for 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid?
The canonical SMILES for 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid is Cc1cc(-c2c[nH]c3ncc(-c4ccccc4)cc23)ccc1C(=O)O.
What is the InChIKey of 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid?
The InChIKey is HYJDKBZVTDLBMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2/c1-13-9-15(7-8-17(13)21(24)25)19-12-23-20-18(19)10-16(11-22-20)14-5-3-2-4-6-14/h2-12H,1H3,(H,22,23)(H,24,25).
What are the key properties of 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid?
2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid has a molecular weight of 328.37 g/mol, XLogP of 4.90, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid is sourced from PubChem (CID 68778433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).