About 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide (PubChem CID 68778450) has the molecular formula C18H17FN6OS
and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide |
| PubChem CID | 68778450 |
| Molecular Formula | C18H17FN6OS |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccnn1)N1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C18H17FN6OS/c19-14-5-3-13(4-6-14)15-12-27-18(21-15)25-10-8-24(9-11-25)17(26)22-16-2-1-7-20-23-16/h1-7,12H,8-11H2,(H,22,23,26) |
| InChIKey | QSJIRCSPICHERJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide?
The IUPAC name of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide (CID 68778450) is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide.
What is the SMILES notation for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide?
The canonical SMILES for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide is O=C(Nc1cccnn1)N1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1.
What is the InChIKey of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide?
The InChIKey is QSJIRCSPICHERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN6OS/c19-14-5-3-13(4-6-14)15-12-27-18(21-15)25-10-8-24(9-11-25)17(26)22-16-2-1-7-20-23-16/h1-7,12H,8-11H2,(H,22,23,26).
What are the key properties of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide?
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide has a molecular weight of 384.44 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-pyridazin-3-ylpiperazine-1-carboxamide is sourced from PubChem (CID 68778450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).