C28H35Cl2N3O2 — CID 68778890
2-(3,4-dichlorophenyl)-1-[4-[(4-methoxyphenyl)methyl]-8-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 68778890) has the molecular formula C28H35Cl2N3O2 and a molecular weight of 516.51 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[4-[(4-methoxyphenyl)methyl]-8-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[4-[(4-methoxyphenyl)methyl]-8-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 68778890 |
| Molecular Formula | C28H35Cl2N3O2 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[4-[(4-methoxyphenyl)methyl]-8-pyrrolidin-1-yl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | COc1ccc(CN2CCN(C(=O)Cc3ccc(Cl)c(Cl)c3)C3C(N4CCCC4)CCCC32)cc1 |
| InChI | InChI=1S/C28H35Cl2N3O2/c1-35-22-10-7-20(8-11-22)19-32-15-16-33(27(34)18-21-9-12-23(29)24(30)17-21)28-25(5-4-6-26(28)32)31-13-2-3-14-31/h7-12,17,25-26,28H,2-6,13-16,18-19H2,1H3 |
| InChIKey | QBCJXEWVKYBDNG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |