C28H33N7O2S — CID 68779470
5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-N-[3-(4-methylpiperazin-1-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 68779470) has the molecular formula C28H33N7O2S and a molecular weight of 531.69 g/mol. Its IUPAC name is 5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-N-[3-(4-methylpiperazin-1-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-N-[3-(4-methylpiperazin-1-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 68779470 |
| Molecular Formula | C28H33N7O2S |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-N-[3-(4-methylpiperazin-1-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CN1CCN(c2cccc(Nc3nc4cccc(-c5ccc(CN6CCS(=O)(=O)CC6)cc5)n4n3)c2)CC1 |
| InChI | InChI=1S/C28H33N7O2S/c1-32-12-14-34(15-13-32)25-5-2-4-24(20-25)29-28-30-27-7-3-6-26(35(27)31-28)23-10-8-22(9-11-23)21-33-16-18-38(36,37)19-17-33/h2-11,20H,12-19,21H2,1H3,(H,29,31) |
| InChIKey | NPELBSOBEYYYKY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |