About 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride
3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride (PubChem CID 68779485) has the molecular formula C16H22Cl3N3O
and a molecular weight of 378.73 g/mol. Its IUPAC name is 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride.
Molecular Properties
| Compound Name | 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride |
| PubChem CID | 68779485 |
| Molecular Formula | C16H22Cl3N3O |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCC1(COc2cncc(-c3cccc(N)c3)c2)CC1 |
| InChI | InChI=1S/C16H19N3O.3ClH/c17-10-16(4-5-16)11-20-15-7-13(8-19-9-15)12-2-1-3-14(18)6-12;;;/h1-3,6-9H,4-5,10-11,17-18H2;3*1H |
| InChIKey | FEBBMISIFNZJMY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride?
The IUPAC name of 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride (CID 68779485) is 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride.
What is the SMILES notation for 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride?
The canonical SMILES for 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride is Cl.Cl.Cl.NCC1(COc2cncc(-c3cccc(N)c3)c2)CC1.
What is the InChIKey of 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride?
The InChIKey is FEBBMISIFNZJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O.3ClH/c17-10-16(4-5-16)11-20-15-7-13(8-19-9-15)12-2-1-3-14(18)6-12;;;/h1-3,6-9H,4-5,10-11,17-18H2;3*1H.
What are the key properties of 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride?
3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride has a molecular weight of 378.73 g/mol, XLogP of 3.71, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[[1-(aminomethyl)cyclopropyl]methoxy]-3-pyridinyl]aniline;trihydrochloride is sourced from PubChem (CID 68779485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).