C9H13N3O5 — CID 68779640
2,2-dimethyl-4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)butanoic acid (PubChem CID 68779640) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)butanoic acid.
| Compound Name | 2,2-dimethyl-4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)butanoic acid |
|---|---|
| PubChem CID | 68779640 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2,2-dimethyl-4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)butanoic acid |
| SMILES | CC(C)(CCn1c(=O)[nH]c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C9H13N3O5/c1-9(2,5(13)14)3-4-12-7(16)10-6(15)11-8(12)17/h3-4H2,1-2H3,(H,13,14)(H2,10,11,15,16,17) |
| InChIKey | CQQWOKLQZVETTG-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |