C19H24F3N7O — CID 68779704
(1R,2R,3S,5R)-6,6-dimethyl-2-[[2-[(1-methylpyrazol-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]bicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 68779704) has the molecular formula C19H24F3N7O and a molecular weight of 423.44 g/mol. Its IUPAC name is (1R,2R,3S,5R)-6,6-dimethyl-2-[[2-[(1-methylpyrazol-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]bicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | (1R,2R,3S,5R)-6,6-dimethyl-2-[[2-[(1-methylpyrazol-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]bicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 68779704 |
| Molecular Formula | C19H24F3N7O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (1R,2R,3S,5R)-6,6-dimethyl-2-[[2-[(1-methylpyrazol-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]bicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | Cn1cc(Nc2ncc(C(F)(F)F)c(N[C@H]3[C@@H](C(N)=O)C[C@H]4C[C@@H]3C4(C)C)n2)cn1 |
| InChI | InChI=1S/C19H24F3N7O/c1-18(2)9-4-11(15(23)30)14(12(18)5-9)27-16-13(19(20,21)22)7-24-17(28-16)26-10-6-25-29(3)8-10/h6-9,11-12,14H,4-5H2,1-3H3,(H2,23,30)(H2,24,26,27,28)/t9-,11-,12-,14-/m0/s1 |
| InChIKey | YLJVNDQEACKRKQ-HVTMNAMFSA-N |
| XLogP | 2.92 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |