C23H27N5O2 — CID 68779907
N-[amino(piperazin-1-yl)methylidene]-9-(oxan-4-yl)carbazole-2-carboxamide (PubChem CID 68779907) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[amino(piperazin-1-yl)methylidene]-9-(oxan-4-yl)carbazole-2-carboxamide.
| Compound Name | N-[amino(piperazin-1-yl)methylidene]-9-(oxan-4-yl)carbazole-2-carboxamide |
|---|---|
| PubChem CID | 68779907 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[amino(piperazin-1-yl)methylidene]-9-(oxan-4-yl)carbazole-2-carboxamide |
| SMILES | N/C(=N\C(=O)c1ccc2c3ccccc3n(C3CCOCC3)c2c1)N1CCNCC1 |
| InChI | InChI=1S/C23H27N5O2/c24-23(27-11-9-25-10-12-27)26-22(29)16-5-6-19-18-3-1-2-4-20(18)28(21(19)15-16)17-7-13-30-14-8-17/h1-6,15,17,25H,7-14H2,(H2,24,26,29) |
| InChIKey | CSIVVMMZQQEARL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|