C19H17F2N3O2S — CID 68779924
[(4aR,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]carbamic acid (PubChem CID 68779924) has the molecular formula C19H17F2N3O2S and a molecular weight of 389.43 g/mol. Its IUPAC name is [(4aR,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]carbamic acid.
| Compound Name | [(4aR,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68779924 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | [(4aR,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]carbamic acid |
| SMILES | O=C(O)NC1=N[C@@]2(c3cc(-c4cccnc4F)ccc3F)CCC[C@H]2CS1 |
| InChI | InChI=1S/C19H17F2N3O2S/c20-15-6-5-11(13-4-2-8-22-16(13)21)9-14(15)19-7-1-3-12(19)10-27-17(24-19)23-18(25)26/h2,4-6,8-9,12H,1,3,7,10H2,(H,23,24)(H,25,26)/t12-,19-/m0/s1 |
| InChIKey | GNPXIUQYHBINLJ-BUXKBTBVSA-N |
| XLogP | 4.39 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|