C27H25F3N2O — CID 68780673
1-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-4-prop-2-enyl-1,3-diazinan-2-one (PubChem CID 68780673) has the molecular formula C27H25F3N2O and a molecular weight of 450.50 g/mol. Its IUPAC name is 1-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-4-prop-2-enyl-1,3-diazinan-2-one.
| Compound Name | 1-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-4-prop-2-enyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 68780673 |
| Molecular Formula | C27H25F3N2O |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 1-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-4-prop-2-enyl-1,3-diazinan-2-one |
| SMILES | C=CCC1(c2ccc(F)cc2)CCN(C(C)c2ccc(-c3ccc(F)cc3F)cc2)C(=O)N1 |
| InChI | InChI=1S/C27H25F3N2O/c1-3-14-27(21-8-10-22(28)11-9-21)15-16-32(26(33)31-27)18(2)19-4-6-20(7-5-19)24-13-12-23(29)17-25(24)30/h3-13,17-18H,1,14-16H2,2H3,(H,31,33) |
| InChIKey | LUQNXTMKSWJXNU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|