About 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride
6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride (PubChem CID 68781324) has the molecular formula C20H31Cl2N5O2
and a molecular weight of 444.41 g/mol. Its IUPAC name is 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride |
| PubChem CID | 68781324 |
| Molecular Formula | C20H31Cl2N5O2 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride |
| SMILES | COc1cc2nc(NC3CCNCC3)nc(N3CCCCC3)c2cc1OC.Cl.Cl |
| InChI | InChI=1S/C20H29N5O2.2ClH/c1-26-17-12-15-16(13-18(17)27-2)23-20(22-14-6-8-21-9-7-14)24-19(15)25-10-4-3-5-11-25;;/h12-14,21H,3-11H2,1-2H3,(H,22,23,24);2*1H |
| InChIKey | ZIXYYMTVJKUXID-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride?
The IUPAC name of 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride (CID 68781324) is 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride.
What is the SMILES notation for 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride?
The canonical SMILES for 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride is COc1cc2nc(NC3CCNCC3)nc(N3CCCCC3)c2cc1OC.Cl.Cl.
What is the InChIKey of 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride?
The InChIKey is ZIXYYMTVJKUXID-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N5O2.2ClH/c1-26-17-12-15-16(13-18(17)27-2)23-20(22-14-6-8-21-9-7-14)24-19(15)25-10-4-3-5-11-25;;/h12-14,21H,3-11H2,1-2H3,(H,22,23,24);2*1H.
What are the key properties of 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride?
6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride has a molecular weight of 444.41 g/mol, XLogP of 3.64, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-4-piperidin-1-yl-N-piperidin-4-ylquinazolin-2-amine;dihydrochloride is sourced from PubChem (CID 68781324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).