C29H15F3O9 — CID 68781432
9-phenyl-9-(2,3,4-trifluorophenyl)xanthene-2,3,6,7-tetracarboxylic acid (PubChem CID 68781432) has the molecular formula C29H15F3O9 and a molecular weight of 564.42 g/mol. Its IUPAC name is 9-phenyl-9-(2,3,4-trifluorophenyl)xanthene-2,3,6,7-tetracarboxylic acid.
| Compound Name | 9-phenyl-9-(2,3,4-trifluorophenyl)xanthene-2,3,6,7-tetracarboxylic acid |
|---|---|
| PubChem CID | 68781432 |
| Molecular Formula | C29H15F3O9 |
| Molecular Weight | 564.42 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 9-phenyl-9-(2,3,4-trifluorophenyl)xanthene-2,3,6,7-tetracarboxylic acid |
| SMILES | O=C(O)c1cc2c(cc1C(=O)O)C(c1ccccc1)(c1ccc(F)c(F)c1F)c1cc(C(=O)O)c(C(=O)O)cc1O2 |
| InChI | InChI=1S/C29H15F3O9/c30-20-7-6-17(23(31)24(20)32)29(12-4-2-1-3-5-12)18-8-13(25(33)34)15(27(37)38)10-21(18)41-22-11-16(28(39)40)14(26(35)36)9-19(22)29/h1-11H,(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | PZYBWFHTODGZIY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|