About (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one
(4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one (PubChem CID 68781802) has the molecular formula C22H32N2O
and a molecular weight of 340.51 g/mol. Its IUPAC name is (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one |
| PubChem CID | 68781802 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one |
| SMILES | C=CC[C@]1(c2ccccc2)CCN([C@@H](C)C2CCCCC2)C(=O)N1C |
| InChI | InChI=1S/C22H32N2O/c1-4-15-22(20-13-9-6-10-14-20)16-17-24(21(25)23(22)3)18(2)19-11-7-5-8-12-19/h4,6,9-10,13-14,18-19H,1,5,7-8,11-12,15-17H2,2-3H3/t18-,22+/m0/s1 |
| InChIKey | JZZKFTHUXRYBLQ-PGRDOPGGSA-N |
| XLogP | 5.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one?
The IUPAC name of (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one (CID 68781802) is (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one.
What is the SMILES notation for (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one?
The canonical SMILES for (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one is C=CC[C@]1(c2ccccc2)CCN([C@@H](C)C2CCCCC2)C(=O)N1C.
What is the InChIKey of (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one?
The InChIKey is JZZKFTHUXRYBLQ-PGRDOPGGSA-N. The full InChI is InChI=1S/C22H32N2O/c1-4-15-22(20-13-9-6-10-14-20)16-17-24(21(25)23(22)3)18(2)19-11-7-5-8-12-19/h4,6,9-10,13-14,18-19H,1,5,7-8,11-12,15-17H2,2-3H3/t18-,22+/m0/s1.
What are the key properties of (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one?
(4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one has a molecular weight of 340.51 g/mol, XLogP of 5.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-[(1S)-1-cyclohexylethyl]-3-methyl-4-phenyl-4-prop-2-enyl-1,3-diazinan-2-one is sourced from PubChem (CID 68781802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).