About (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine
(2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine (PubChem CID 68782015) has the molecular formula C17H26FNOS
and a molecular weight of 311.47 g/mol. Its IUPAC name is (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine.
Molecular Properties
| Compound Name | (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine |
| PubChem CID | 68782015 |
| Molecular Formula | C17H26FNOS |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)N1CCC[C@@H]1CF |
| InChI | InChI=1S/C17H26FNOS/c1-12-9-14(17(3,4)5)10-13(2)16(12)21(20)19-8-6-7-15(19)11-18/h9-10,15H,6-8,11H2,1-5H3/t15-,21?/m1/s1 |
| InChIKey | NCLIAQSAEIFJKS-RBFZIWAESA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine?
The IUPAC name of (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine (CID 68782015) is (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine.
What is the SMILES notation for (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine?
The canonical SMILES for (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine is Cc1cc(C(C)(C)C)cc(C)c1S(=O)N1CCC[C@@H]1CF.
What is the InChIKey of (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine?
The InChIKey is NCLIAQSAEIFJKS-RBFZIWAESA-N. The full InChI is InChI=1S/C17H26FNOS/c1-12-9-14(17(3,4)5)10-13(2)16(12)21(20)19-8-6-7-15(19)11-18/h9-10,15H,6-8,11H2,1-5H3/t15-,21?/m1/s1.
What are the key properties of (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine?
(2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine has a molecular weight of 311.47 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(4-tert-butyl-2,6-dimethylphenyl)sulfinyl-2-(fluoromethyl)pyrrolidine is sourced from PubChem (CID 68782015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).