C13H18O2 — CID 68782187
3,3-diethoxyprop-2-enylbenzene (PubChem CID 68782187) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 3,3-diethoxyprop-2-enylbenzene.
| Compound Name | 3,3-diethoxyprop-2-enylbenzene |
|---|---|
| PubChem CID | 68782187 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3,3-diethoxyprop-2-enylbenzene |
| SMILES | CCOC(=CCc1ccccc1)OCC |
| InChI | InChI=1S/C13H18O2/c1-3-14-13(15-4-2)11-10-12-8-6-5-7-9-12/h5-9,11H,3-4,10H2,1-2H3 |
| InChIKey | MNRFKZHVSWWNAJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|