About (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one
(3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one (PubChem CID 68782306) has the molecular formula C14H11ClFN3O3
and a molecular weight of 323.71 g/mol. Its IUPAC name is (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one |
| PubChem CID | 68782306 |
| Molecular Formula | C14H11ClFN3O3 |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one |
| SMILES | N[C@H]1Cc2cc(Oc3cc(F)cc(Cl)c3)cnc2N(O)C1=O |
| InChI | InChI=1S/C14H11ClFN3O3/c15-8-3-9(16)5-10(4-8)22-11-1-7-2-12(17)14(20)19(21)13(7)18-6-11/h1,3-6,12,21H,2,17H2/t12-/m0/s1 |
| InChIKey | MOHILKDVEDQUGL-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one?
The IUPAC name of (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one (CID 68782306) is (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one.
What is the SMILES notation for (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one?
The canonical SMILES for (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one is N[C@H]1Cc2cc(Oc3cc(F)cc(Cl)c3)cnc2N(O)C1=O.
What is the InChIKey of (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one?
The InChIKey is MOHILKDVEDQUGL-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H11ClFN3O3/c15-8-3-9(16)5-10(4-8)22-11-1-7-2-12(17)14(20)19(21)13(7)18-6-11/h1,3-6,12,21H,2,17H2/t12-/m0/s1.
What are the key properties of (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one?
(3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one has a molecular weight of 323.71 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-6-(3-chloro-5-fluorophenoxy)-1-hydroxy-3,4-dihydro-1,8-naphthyridin-2-one is sourced from PubChem (CID 68782306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).