About 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride
3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride (PubChem CID 68782480) has the molecular formula C17H20Cl2N2O3
and a molecular weight of 371.26 g/mol. Its IUPAC name is 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride |
| PubChem CID | 68782480 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride |
| SMILES | CNC1(COc2cncc(-c3cccc(C(=O)O)c3)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H18N2O3.2ClH/c1-18-17(5-6-17)11-22-15-8-14(9-19-10-15)12-3-2-4-13(7-12)16(20)21;;/h2-4,7-10,18H,5-6,11H2,1H3,(H,20,21);2*1H |
| InChIKey | HZXAUSCPFCJHJJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride?
The IUPAC name of 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride (CID 68782480) is 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride.
What is the SMILES notation for 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride?
The canonical SMILES for 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride is CNC1(COc2cncc(-c3cccc(C(=O)O)c3)c2)CC1.Cl.Cl.
What is the InChIKey of 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride?
The InChIKey is HZXAUSCPFCJHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3.2ClH/c1-18-17(5-6-17)11-22-15-8-14(9-19-10-15)12-3-2-4-13(7-12)16(20)21;;/h2-4,7-10,18H,5-6,11H2,1H3,(H,20,21);2*1H.
What are the key properties of 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride?
3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride has a molecular weight of 371.26 g/mol, XLogP of 3.42, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride is sourced from PubChem (CID 68782480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).