C28H21F2N7O2 — CID 68782536
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-6-methyl-5-[3-(5H-pyrrolo[3,2-d]pyrimidin-4-yl)-2-pyridinyl]isoquinoline;hydrazine (PubChem CID 68782536) has the molecular formula C28H21F2N7O2 and a molecular weight of 525.52 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-6-methyl-5-[3-(5H-pyrrolo[3,2-d]pyrimidin-4-yl)-2-pyridinyl]isoquinoline;hydrazine.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-6-methyl-5-[3-(5H-pyrrolo[3,2-d]pyrimidin-4-yl)-2-pyridinyl]isoquinoline;hydrazine |
|---|---|
| PubChem CID | 68782536 |
| Molecular Formula | C28H21F2N7O2 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-6-methyl-5-[3-(5H-pyrrolo[3,2-d]pyrimidin-4-yl)-2-pyridinyl]isoquinoline;hydrazine |
| SMILES | Cc1ccc2c(-c3ccc4c(c3)OC(F)(F)O4)nccc2c1-c1ncccc1-c1ncnc2cc[nH]c12.NN |
| InChI | InChI=1S/C28H17F2N5O2.H4N2/c1-15-4-6-18-17(8-11-32-24(18)16-5-7-21-22(13-16)37-28(29,30)36-21)23(15)25-19(3-2-10-31-25)26-27-20(9-12-33-27)34-14-35-26;1-2/h2-14,33H,1H3;1-2H2 |
| InChIKey | SLJLEYRQFDPZCE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|