C26H37FN4O3 — CID 68782738
N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5,5,7,7-tetramethylfuro[3,4-d]pyrimidin-2-amine (PubChem CID 68782738) has the molecular formula C26H37FN4O3 and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5,5,7,7-tetramethylfuro[3,4-d]pyrimidin-2-amine.
| Compound Name | N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5,5,7,7-tetramethylfuro[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68782738 |
| Molecular Formula | C26H37FN4O3 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5,5,7,7-tetramethylfuro[3,4-d]pyrimidin-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ncc4c(n3)C(C)(C)OC4(C)C)CC2)cc(OCC)c1F |
| InChI | InChI=1S/C26H37FN4O3/c1-7-32-20-13-17(14-21(22(20)27)33-8-2)16-31-11-9-18(10-12-31)29-24-28-15-19-23(30-24)26(5,6)34-25(19,3)4/h13-15,18H,7-12,16H2,1-6H3,(H,28,29,30) |
| InChIKey | VRSIBDKOKDWLCG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |