C24H22F3N4O8P — CID 68782849
[2-[[4-[[5-(2-amino-3-pyridinyl)-1,2-oxazol-3-yl]methyl]phenoxy]methyl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate;2,2,2-trifluoroacetate (PubChem CID 68782849) has the molecular formula C24H22F3N4O8P and a molecular weight of 582.43 g/mol. Its IUPAC name is [2-[[4-[[5-(2-amino-3-pyridinyl)-1,2-oxazol-3-yl]methyl]phenoxy]methyl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate;2,2,2-trifluoroacetate.
| Compound Name | [2-[[4-[[5-(2-amino-3-pyridinyl)-1,2-oxazol-3-yl]methyl]phenoxy]methyl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68782849 |
| Molecular Formula | C24H22F3N4O8P |
| Molecular Weight | 582.43 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | [2-[[4-[[5-(2-amino-3-pyridinyl)-1,2-oxazol-3-yl]methyl]phenoxy]methyl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate;2,2,2-trifluoroacetate |
| SMILES | Nc1ncccc1-c1cc(Cc2ccc(OCc3cccc[n+]3COP(=O)(O)O)cc2)no1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C22H21N4O6P.C2HF3O2/c23-22-20(5-3-10-24-22)21-13-17(25-32-21)12-16-6-8-19(9-7-16)30-14-18-4-1-2-11-26(18)15-31-33(27,28)29;3-2(4,5)1(6)7/h1-11,13H,12,14-15H2,(H3-,23,24,27,28,29);(H,6,7) |
| InChIKey | NVJYJFNCPXMSEF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 184.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|