C11H11N5O3 — CID 68782875
3-amino-1-hydroxy-6-(1H-1,2,4-triazol-5-yloxy)-3,4-dihydroquinolin-2-one (PubChem CID 68782875) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is 3-amino-1-hydroxy-6-(1H-1,2,4-triazol-5-yloxy)-3,4-dihydroquinolin-2-one.
| Compound Name | 3-amino-1-hydroxy-6-(1H-1,2,4-triazol-5-yloxy)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 68782875 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-amino-1-hydroxy-6-(1H-1,2,4-triazol-5-yloxy)-3,4-dihydroquinolin-2-one |
| SMILES | NC1Cc2cc(Oc3ncn[nH]3)ccc2N(O)C1=O |
| InChI | InChI=1S/C11H11N5O3/c12-8-4-6-3-7(19-11-13-5-14-15-11)1-2-9(6)16(18)10(8)17/h1-3,5,8,18H,4,12H2,(H,13,14,15) |
| InChIKey | BKBCNFHEUGHXBN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|