About 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol
2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol (PubChem CID 68783278) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol |
| PubChem CID | 68783278 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol |
| SMILES | OCCC1(NC(C2=CC=CCC2)C2=COC=CO2)CCNCC1 |
| InChI | InChI=1S/C18H26N2O3/c21-11-8-18(6-9-19-10-7-18)20-17(15-4-2-1-3-5-15)16-14-22-12-13-23-16/h1-2,4,12-14,17,19-21H,3,5-11H2 |
| InChIKey | ZLVJKSXRYJLPKO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol?
The IUPAC name of 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol (CID 68783278) is 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol.
What is the SMILES notation for 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol?
The canonical SMILES for 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol is OCCC1(NC(C2=CC=CCC2)C2=COC=CO2)CCNCC1.
What is the InChIKey of 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol?
The InChIKey is ZLVJKSXRYJLPKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O3/c21-11-8-18(6-9-19-10-7-18)20-17(15-4-2-1-3-5-15)16-14-22-12-13-23-16/h1-2,4,12-14,17,19-21H,3,5-11H2.
What are the key properties of 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol?
2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol has a molecular weight of 318.42 g/mol, XLogP of 2.09, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]piperidin-4-yl]ethanol is sourced from PubChem (CID 68783278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).