C18H21N3O4 — CID 68783579
(E)-but-2-enedioic acid;4-[1-(1H-imidazol-5-yl)ethyl]-5,6,7,8-tetrahydroquinoline (PubChem CID 68783579) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-[1-(1H-imidazol-5-yl)ethyl]-5,6,7,8-tetrahydroquinoline.
| Compound Name | (E)-but-2-enedioic acid;4-[1-(1H-imidazol-5-yl)ethyl]-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 68783579 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (E)-but-2-enedioic acid;4-[1-(1H-imidazol-5-yl)ethyl]-5,6,7,8-tetrahydroquinoline |
| SMILES | CC(c1cnc[nH]1)c1ccnc2c1CCCC2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H17N3.C4H4O4/c1-10(14-8-15-9-17-14)11-6-7-16-13-5-3-2-4-12(11)13;5-3(6)1-2-4(7)8/h6-10H,2-5H2,1H3,(H,15,17);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HQSOBMDEMJJTSN-WLHGVMLRSA-N |
| XLogP | 2.55 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|