About CID 68784292
CID 68784292 (PubChem CID 68784292) has the molecular formula C8H17Si
and a molecular weight of 141.31 g/mol.
Molecular Properties
| Compound Name | CID 68784292 |
| PubChem CID | 68784292 |
| Molecular Formula | C8H17Si |
| Molecular Weight | 141.31 g/mol |
| Exact Mass | 141.11 |
| IUPAC Name | — |
| SMILES | C[Si](C)C1(C)CCCC1 |
| InChI | InChI=1S/C8H17Si/c1-8(9(2)3)6-4-5-7-8/h4-7H2,1-3H3 |
| InChIKey | VFIZEZCZHDXVIK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68784292 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68784292?
The IUPAC name of CID 68784292 (CID 68784292) is not available.
What is the SMILES notation for CID 68784292?
The canonical SMILES for CID 68784292 is C[Si](C)C1(C)CCCC1.
What is the InChIKey of CID 68784292?
The InChIKey is VFIZEZCZHDXVIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17Si/c1-8(9(2)3)6-4-5-7-8/h4-7H2,1-3H3.
What are the key properties of CID 68784292?
CID 68784292 has a molecular weight of 141.31 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68784292 is sourced from PubChem (CID 68784292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).