About [2,4-bis(ethylsulfanyl)phenyl]boronic acid
[2,4-bis(ethylsulfanyl)phenyl]boronic acid (PubChem CID 68784295) has the molecular formula C10H15BO2S2
and a molecular weight of 242.17 g/mol. Its IUPAC name is [2,4-bis(ethylsulfanyl)phenyl]boronic acid.
Molecular Properties
| Compound Name | [2,4-bis(ethylsulfanyl)phenyl]boronic acid |
| PubChem CID | 68784295 |
| Molecular Formula | C10H15BO2S2 |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | [2,4-bis(ethylsulfanyl)phenyl]boronic acid |
| SMILES | CCSc1ccc(B(O)O)c(SCC)c1 |
| InChI | InChI=1S/C10H15BO2S2/c1-3-14-8-5-6-9(11(12)13)10(7-8)15-4-2/h5-7,12-13H,3-4H2,1-2H3 |
| InChIKey | ROAQQPGYUAVZQP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,4-bis(ethylsulfanyl)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(ethylsulfanyl)phenyl]boronic acid?
The IUPAC name of [2,4-bis(ethylsulfanyl)phenyl]boronic acid (CID 68784295) is [2,4-bis(ethylsulfanyl)phenyl]boronic acid.
What is the SMILES notation for [2,4-bis(ethylsulfanyl)phenyl]boronic acid?
The canonical SMILES for [2,4-bis(ethylsulfanyl)phenyl]boronic acid is CCSc1ccc(B(O)O)c(SCC)c1.
What is the InChIKey of [2,4-bis(ethylsulfanyl)phenyl]boronic acid?
The InChIKey is ROAQQPGYUAVZQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BO2S2/c1-3-14-8-5-6-9(11(12)13)10(7-8)15-4-2/h5-7,12-13H,3-4H2,1-2H3.
What are the key properties of [2,4-bis(ethylsulfanyl)phenyl]boronic acid?
[2,4-bis(ethylsulfanyl)phenyl]boronic acid has a molecular weight of 242.17 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(ethylsulfanyl)phenyl]boronic acid is sourced from PubChem (CID 68784295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).