C19H18FN3O2 — CID 68784702
2,4-diethoxy-6-(2-fluoro-3-phenylphenyl)-1,3,5-triazine (PubChem CID 68784702) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2,4-diethoxy-6-(2-fluoro-3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-diethoxy-6-(2-fluoro-3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 68784702 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2,4-diethoxy-6-(2-fluoro-3-phenylphenyl)-1,3,5-triazine |
| SMILES | CCOc1nc(OCC)nc(-c2cccc(-c3ccccc3)c2F)n1 |
| InChI | InChI=1S/C19H18FN3O2/c1-3-24-18-21-17(22-19(23-18)25-4-2)15-12-8-11-14(16(15)20)13-9-6-5-7-10-13/h5-12H,3-4H2,1-2H3 |
| InChIKey | DUXNKJIHQABOFG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |