C21H24O7 — CID 68784914
(1S,13R,16R,17R)-15-(4-methoxyphenoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-triene-16,17-diol (PubChem CID 68784914) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is (1S,13R,16R,17R)-15-(4-methoxyphenoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-triene-16,17-diol.
| Compound Name | (1S,13R,16R,17R)-15-(4-methoxyphenoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-triene-16,17-diol |
|---|---|
| PubChem CID | 68784914 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (1S,13R,16R,17R)-15-(4-methoxyphenoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-triene-16,17-diol |
| SMILES | COc1ccc(OC2O[C@@H]3COCc4ccccc4CO[C@@H]([C@@H]3O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H24O7/c1-24-15-6-8-16(9-7-15)27-21-19(23)20-18(22)17(28-21)12-25-10-13-4-2-3-5-14(13)11-26-20/h2-9,17-23H,10-12H2,1H3/t17-,18-,19-,20+,21?/m1/s1 |
| InChIKey | WKXRFXIYQZBBCD-APISQKPESA-N |
| XLogP | 1.64 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |