About N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine
N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine (PubChem CID 68785323) has the molecular formula C22H31FN4O2
and a molecular weight of 402.51 g/mol. Its IUPAC name is N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine |
| PubChem CID | 68785323 |
| Molecular Formula | C22H31FN4O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ncc(CC)cn3)CC2)cc(OCC)c1F |
| InChI | InChI=1S/C22H31FN4O2/c1-4-16-13-24-22(25-14-16)26-18-7-9-27(10-8-18)15-17-11-19(28-5-2)21(23)20(12-17)29-6-3/h11-14,18H,4-10,15H2,1-3H3,(H,24,25,26) |
| InChIKey | DPZGGTFSIDGHEJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine?
The IUPAC name of N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine (CID 68785323) is N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine.
What is the SMILES notation for N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine?
The canonical SMILES for N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine is CCOc1cc(CN2CCC(Nc3ncc(CC)cn3)CC2)cc(OCC)c1F.
What is the InChIKey of N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine?
The InChIKey is DPZGGTFSIDGHEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31FN4O2/c1-4-16-13-24-22(25-14-16)26-18-7-9-27(10-8-18)15-17-11-19(28-5-2)21(23)20(12-17)29-6-3/h11-14,18H,4-10,15H2,1-3H3,(H,24,25,26).
What are the key properties of N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine?
N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine has a molecular weight of 402.51 g/mol, XLogP of 4.05, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-5-ethylpyrimidin-2-amine is sourced from PubChem (CID 68785323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).