About 6-(3-aminophenyl)-2,3-dimethylaniline
6-(3-aminophenyl)-2,3-dimethylaniline (PubChem CID 68785658) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 6-(3-aminophenyl)-2,3-dimethylaniline.
Molecular Properties
| Compound Name | 6-(3-aminophenyl)-2,3-dimethylaniline |
| PubChem CID | 68785658 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 6-(3-aminophenyl)-2,3-dimethylaniline |
| SMILES | Cc1ccc(-c2cccc(N)c2)c(N)c1C |
| InChI | InChI=1S/C14H16N2/c1-9-6-7-13(14(16)10(9)2)11-4-3-5-12(15)8-11/h3-8H,15-16H2,1-2H3 |
| InChIKey | FRSMXYRPUZSPAY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-aminophenyl)-2,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-aminophenyl)-2,3-dimethylaniline?
The IUPAC name of 6-(3-aminophenyl)-2,3-dimethylaniline (CID 68785658) is 6-(3-aminophenyl)-2,3-dimethylaniline.
What is the SMILES notation for 6-(3-aminophenyl)-2,3-dimethylaniline?
The canonical SMILES for 6-(3-aminophenyl)-2,3-dimethylaniline is Cc1ccc(-c2cccc(N)c2)c(N)c1C.
What is the InChIKey of 6-(3-aminophenyl)-2,3-dimethylaniline?
The InChIKey is FRSMXYRPUZSPAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-9-6-7-13(14(16)10(9)2)11-4-3-5-12(15)8-11/h3-8H,15-16H2,1-2H3.
What are the key properties of 6-(3-aminophenyl)-2,3-dimethylaniline?
6-(3-aminophenyl)-2,3-dimethylaniline has a molecular weight of 212.30 g/mol, XLogP of 3.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-aminophenyl)-2,3-dimethylaniline is sourced from PubChem (CID 68785658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).