About pent-1-en-3-yl cyclohex-3-ene-1-carboxylate
pent-1-en-3-yl cyclohex-3-ene-1-carboxylate (PubChem CID 68786203) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is pent-1-en-3-yl cyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | pent-1-en-3-yl cyclohex-3-ene-1-carboxylate |
| PubChem CID | 68786203 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | pent-1-en-3-yl cyclohex-3-ene-1-carboxylate |
| SMILES | C=CC(CC)OC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C12H18O2/c1-3-11(4-2)14-12(13)10-8-6-5-7-9-10/h3,5-6,10-11H,1,4,7-9H2,2H3 |
| InChIKey | RPNAOFPVLOAQCF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-1-en-3-yl cyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-1-en-3-yl cyclohex-3-ene-1-carboxylate?
The IUPAC name of pent-1-en-3-yl cyclohex-3-ene-1-carboxylate (CID 68786203) is pent-1-en-3-yl cyclohex-3-ene-1-carboxylate.
What is the SMILES notation for pent-1-en-3-yl cyclohex-3-ene-1-carboxylate?
The canonical SMILES for pent-1-en-3-yl cyclohex-3-ene-1-carboxylate is C=CC(CC)OC(=O)C1CC=CCC1.
What is the InChIKey of pent-1-en-3-yl cyclohex-3-ene-1-carboxylate?
The InChIKey is RPNAOFPVLOAQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-3-11(4-2)14-12(13)10-8-6-5-7-9-10/h3,5-6,10-11H,1,4,7-9H2,2H3.
What are the key properties of pent-1-en-3-yl cyclohex-3-ene-1-carboxylate?
pent-1-en-3-yl cyclohex-3-ene-1-carboxylate has a molecular weight of 194.27 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pent-1-en-3-yl cyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 68786203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).